C25H44O6 — CID 91231233
propan-2-yl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate (PubChem CID 91231233) has the molecular formula C25H44O6 and a molecular weight of 440.62 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91231233 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | propan-2-yl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC1(CC[C@@H]2[C@@H](CC=CCCCC(=O)OC(C)C)[C@@H](O)C[C@H]2O)OCCO1 |
| InChI | InChI=1S/C25H44O6/c1-4-5-10-14-25(29-16-17-30-25)15-13-21-20(22(26)18-23(21)27)11-8-6-7-9-12-24(28)31-19(2)3/h6,8,19-23,26-27H,4-5,7,9-18H2,1-3H3/t20-,21-,22+,23-/m1/s1 |
| InChIKey | HQNBEHREQXGZMJ-BXXSPATCSA-N |
| XLogP | 4.52 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|