C28H48O6 — CID 66624070
propan-2-yl 7-[(1R,2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoate (PubChem CID 66624070) has the molecular formula C28H48O6 and a molecular weight of 480.69 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[(1R,2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 66624070 |
| Molecular Formula | C28H48O6 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | propan-2-yl 7-[(1R,2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC1(CC[C@H]2[C@H](CO)CC(=O)[C@@H]2CC=CCCCC(=O)OC(C)C)OCCO1 |
| InChI | InChI=1S/C28H48O6/c1-4-5-6-9-12-16-28(32-18-19-33-28)17-15-24-23(21-29)20-26(30)25(24)13-10-7-8-11-14-27(31)34-22(2)3/h7,10,22-25,29H,4-6,8-9,11-21H2,1-3H3/t23-,24-,25+/m0/s1 |
| InChIKey | QQQSWMDZDJZART-CCDWMCETSA-N |
| XLogP | 5.75 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|