C28H49IO5 — CID 123448235
(2R,3R,4R)-3-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-2-(7-hydroperoxy-8-methylnon-2-enyl)-4-(iodomethyl)cyclopentan-1-one (PubChem CID 123448235) has the molecular formula C28H49IO5 and a molecular weight of 592.60 g/mol. Its IUPAC name is (2R,3R,4R)-3-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-2-(7-hydroperoxy-8-methylnon-2-enyl)-4-(iodomethyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-2-(7-hydroperoxy-8-methylnon-2-enyl)-4-(iodomethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 123448235 |
| Molecular Formula | C28H49IO5 |
| Molecular Weight | 592.60 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | (2R,3R,4R)-3-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-2-(7-hydroperoxy-8-methylnon-2-enyl)-4-(iodomethyl)cyclopentan-1-one |
| SMILES | CCCCCCCC1(CC[C@H]2[C@H](CI)CC(=O)[C@@H]2CC=CCCCC(OO)C(C)C)OCCO1 |
| InChI | InChI=1S/C28H49IO5/c1-4-5-6-9-12-16-28(32-18-19-33-28)17-15-24-23(21-29)20-26(30)25(24)13-10-7-8-11-14-27(34-31)22(2)3/h7,10,22-25,27,31H,4-6,8-9,11-21H2,1-3H3/t23-,24-,25+,27?/m0/s1 |
| InChIKey | ULKTUHCONVZHOF-BJYSZKJRSA-N |
| XLogP | 7.76 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.60 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|