C34H58O7 — CID 131722601
propan-2-yl (Z)-9-[(1R,2R,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]non-7-enoate (PubChem CID 131722601) has the molecular formula C34H58O7 and a molecular weight of 578.83 g/mol. Its IUPAC name is propan-2-yl (Z)-9-[(1R,2R,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]non-7-enoate.
| Compound Name | propan-2-yl (Z)-9-[(1R,2R,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]non-7-enoate |
|---|---|
| PubChem CID | 131722601 |
| Molecular Formula | C34H58O7 |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | propan-2-yl (Z)-9-[(1R,2R,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]non-7-enoate |
| SMILES | CCCCCCCC1(CC[C@H]2[C@H](OC3CCCCO3)CC(=O)[C@@H]2C/C=C\CCCCCC(=O)OC(C)C)OCCO1 |
| InChI | InChI=1S/C34H58O7/c1-4-5-6-11-15-21-34(38-24-25-39-34)22-20-29-28(30(35)26-31(29)41-33-19-14-16-23-37-33)17-12-9-7-8-10-13-18-32(36)40-27(2)3/h9,12,27-29,31,33H,4-8,10-11,13-26H2,1-3H3/b12-9-/t28-,29-,31-,33?/m1/s1 |
| InChIKey | NOLJQSRIPULMNB-YSNBEEOLSA-N |
| XLogP | 7.84 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|