C24H41O7P — CID 91073148
methyl 7-[(2R)-2-[2-[2-(5-methoxypentyl)-1,3-dioxolan-2-yl]ethyl]-5-oxo-3-phosphanyloxycyclopentyl]hept-5-enoate (PubChem CID 91073148) has the molecular formula C24H41O7P and a molecular weight of 472.56 g/mol. Its IUPAC name is methyl 7-[(2R)-2-[2-[2-(5-methoxypentyl)-1,3-dioxolan-2-yl]ethyl]-5-oxo-3-phosphanyloxycyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(2R)-2-[2-[2-(5-methoxypentyl)-1,3-dioxolan-2-yl]ethyl]-5-oxo-3-phosphanyloxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91073148 |
| Molecular Formula | C24H41O7P |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | methyl 7-[(2R)-2-[2-[2-(5-methoxypentyl)-1,3-dioxolan-2-yl]ethyl]-5-oxo-3-phosphanyloxycyclopentyl]hept-5-enoate |
| SMILES | COCCCCCC1(CC[C@H]2C(OP)CC(=O)C2CC=CCCCC(=O)OC)OCCO1 |
| InChI | InChI=1S/C24H41O7P/c1-27-15-9-5-8-13-24(29-16-17-30-24)14-12-20-19(21(25)18-22(20)31-32)10-6-3-4-7-11-23(26)28-2/h3,6,19-20,22H,4-5,7-18,32H2,1-2H3/t19?,20-,22?/m1/s1 |
| InChIKey | ZRGLKKLXKNMPHG-SNCIUUNGSA-N |
| XLogP | 4.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|