C27H44O7S — CID 90734957
methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-3-acetylsulfanyl-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate (PubChem CID 90734957) has the molecular formula C27H44O7S and a molecular weight of 512.71 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-3-acetylsulfanyl-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-3-acetylsulfanyl-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90734957 |
| Molecular Formula | C27H44O7S |
| Molecular Weight | 512.71 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-3-acetylsulfanyl-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC1(CC[C@@H]2[C@@H](CC=CCCCC(=O)OC)[C@@H](OC(C)=O)C[C@H]2SC(C)=O)OCCO1 |
| InChI | InChI=1S/C27H44O7S/c1-5-6-11-15-27(32-17-18-33-27)16-14-23-22(12-9-7-8-10-13-26(30)31-4)24(34-20(2)28)19-25(23)35-21(3)29/h7,9,22-25H,5-6,8,10-19H2,1-4H3/t22-,23-,24+,25-/m1/s1 |
| InChIKey | OXKUPXLJNFQMRN-ZKGSSEMHSA-N |
| XLogP | 5.60 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|