C26H43IO5 — CID 59773076
propan-2-yl (Z)-7-[(1R,2R,3R)-3-(iodomethyl)-5-oxo-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate (PubChem CID 59773076) has the molecular formula C26H43IO5 and a molecular weight of 562.53 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R)-3-(iodomethyl)-5-oxo-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R)-3-(iodomethyl)-5-oxo-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59773076 |
| Molecular Formula | C26H43IO5 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R)-3-(iodomethyl)-5-oxo-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC1(CC[C@H]2[C@H](CI)CC(=O)[C@@H]2C/C=C\CCCC(=O)OC(C)C)OCCO1 |
| InChI | InChI=1S/C26H43IO5/c1-4-5-10-14-26(30-16-17-31-26)15-13-22-21(19-27)18-24(28)23(22)11-8-6-7-9-12-25(29)32-20(2)3/h6,8,20-23H,4-5,7,9-19H2,1-3H3/b8-6-/t21-,22-,23+/m0/s1 |
| InChIKey | GYVNFDRZWYJHBC-PGEMADLUSA-N |
| XLogP | 6.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|