C34H54O7S — CID 142660712
propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxy-3-(4-methylphenyl)sulfonylcyclopentyl]hept-5-enoate (PubChem CID 142660712) has the molecular formula C34H54O7S and a molecular weight of 606.87 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxy-3-(4-methylphenyl)sulfonylcyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxy-3-(4-methylphenyl)sulfonylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 142660712 |
| Molecular Formula | C34H54O7S |
| Molecular Weight | 606.87 g/mol |
| Exact Mass | 606.36 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxy-3-(4-methylphenyl)sulfonylcyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC1(CC[C@@H]2[C@@H](C/C=C\CCCC(=O)OC(C)C)[C@@H](O)C[C@H]2S(=O)(=O)c2ccc(C)cc2)OCCO1 |
| InChI | InChI=1S/C34H54O7S/c1-5-6-7-10-13-21-34(39-23-24-40-34)22-20-30-29(14-11-8-9-12-15-33(36)41-26(2)3)31(35)25-32(30)42(37,38)28-18-16-27(4)17-19-28/h8,11,16-19,26,29-32,35H,5-7,9-10,12-15,20-25H2,1-4H3/b11-8-/t29-,30-,31+,32-/m1/s1 |
| InChIKey | TWHUXOHQOZGPKG-LRVNOZIESA-N |
| XLogP | 7.09 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.87 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|