C22H39O6P — CID 59963403
(Z)-7-[(2R)-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]-3-phosphanyloxycyclopentyl]hept-5-enoic acid (PubChem CID 59963403) has the molecular formula C22H39O6P and a molecular weight of 430.52 g/mol. Its IUPAC name is (Z)-7-[(2R)-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]-3-phosphanyloxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2R)-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59963403 |
| Molecular Formula | C22H39O6P |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (Z)-7-[(2R)-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC1(CC[C@H]2C(OP)CC(O)C2C/C=C\CCCC(=O)O)OCCO1 |
| InChI | InChI=1S/C22H39O6P/c1-2-3-8-12-22(26-14-15-27-22)13-11-18-17(19(23)16-20(18)28-29)9-6-4-5-7-10-21(24)25/h4,6,17-20,23H,2-3,5,7-16,29H2,1H3,(H,24,25)/b6-4-/t17?,18-,19?,20?/m1/s1 |
| InChIKey | LYSMKVRIMRZGFP-VZALJXEMSA-N |
| XLogP | 4.46 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|