C17H30O5 — CID 88841205
2-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde (PubChem CID 88841205) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde.
| Compound Name | 2-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 88841205 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde |
| SMILES | CCCCCC1(CC[C@@H]2[C@@H](CC=O)[C@@H](O)C[C@H]2O)OCCO1 |
| InChI | InChI=1S/C17H30O5/c1-2-3-4-7-17(21-10-11-22-17)8-5-13-14(6-9-18)16(20)12-15(13)19/h9,13-16,19-20H,2-8,10-12H2,1H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | SQSMHKVOLMBJFF-FPCVCCKLSA-N |
| XLogP | 2.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|