C16H30O3 — CID 68746614
trans-(1R,2R)-3-methyl-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentan-1-ol (PubChem CID 68746614) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is trans-(1R,2R)-3-methyl-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-3-methyl-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 68746614 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | trans-(1R,2R)-3-methyl-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentan-1-ol |
| SMILES | CCCCCC1(CC[C@@H]2C(C)CC[C@H]2O)OCCO1 |
| InChI | InChI=1S/C16H30O3/c1-3-4-5-9-16(18-11-12-19-16)10-8-14-13(2)6-7-15(14)17/h13-15,17H,3-12H2,1-2H3/t13?,14-,15-/m1/s1 |
| InChIKey | QMOFWWCWXUQIDW-JVIGXAJISA-N |
| XLogP | 3.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|