About 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane
2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane (PubChem CID 143254980) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane |
| PubChem CID | 143254980 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane |
| SMILES | CCCCCCCC1(CCC2CCCC2)OCCCO1 |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-8-13-18(19-15-9-16-20-18)14-12-17-10-6-7-11-17/h17H,2-16H2,1H3 |
| InChIKey | DHXQJVWJAVFUEW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane?
The IUPAC name of 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane (CID 143254980) is 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane.
What is the SMILES notation for 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane?
The canonical SMILES for 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane is CCCCCCCC1(CCC2CCCC2)OCCCO1.
What is the InChIKey of 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane?
The InChIKey is DHXQJVWJAVFUEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2/c1-2-3-4-5-8-13-18(19-15-9-16-20-18)14-12-17-10-6-7-11-17/h17H,2-16H2,1H3.
What are the key properties of 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane?
2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane has a molecular weight of 282.47 g/mol, XLogP of 5.45, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclopentylethyl)-2-heptyl-1,3-dioxane is sourced from PubChem (CID 143254980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).