C20H36O5 — CID 90222652
(4R)-4-[2-(2-heptyl-1,3-dioxan-2-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 90222652) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is (4R)-4-[2-(2-heptyl-1,3-dioxan-2-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (4R)-4-[2-(2-heptyl-1,3-dioxan-2-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 90222652 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (4R)-4-[2-(2-heptyl-1,3-dioxan-2-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | CCCCCCCC1(CC[C@H]2C(O)CC3OC(O)CC32)OCCCO1 |
| InChI | InChI=1S/C20H36O5/c1-2-3-4-5-6-9-20(23-11-7-12-24-20)10-8-15-16-13-19(22)25-18(16)14-17(15)21/h15-19,21-22H,2-14H2,1H3/t15-,16?,17?,18?,19?/m1/s1 |
| InChIKey | BWHGJTWRUATCGV-CPZBXZKTSA-N |
| XLogP | 3.36 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|