About ethane;2-heptyl-2-propyl-1,3-dioxolane
ethane;2-heptyl-2-propyl-1,3-dioxolane (PubChem CID 144819660) has the molecular formula C15H32O2
and a molecular weight of 244.42 g/mol. Its IUPAC name is ethane;2-heptyl-2-propyl-1,3-dioxolane.
Molecular Properties
| Compound Name | ethane;2-heptyl-2-propyl-1,3-dioxolane |
| PubChem CID | 144819660 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | ethane;2-heptyl-2-propyl-1,3-dioxolane |
| SMILES | CC.CCCCCCCC1(CCC)OCCO1 |
| InChI | InChI=1S/C13H26O2.C2H6/c1-3-5-6-7-8-10-13(9-4-2)14-11-12-15-13;1-2/h3-12H2,1-2H3;1-2H3 |
| InChIKey | QHOLAZZEJDTMFC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-heptyl-2-propyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-heptyl-2-propyl-1,3-dioxolane?
The IUPAC name of ethane;2-heptyl-2-propyl-1,3-dioxolane (CID 144819660) is ethane;2-heptyl-2-propyl-1,3-dioxolane.
What is the SMILES notation for ethane;2-heptyl-2-propyl-1,3-dioxolane?
The canonical SMILES for ethane;2-heptyl-2-propyl-1,3-dioxolane is CC.CCCCCCCC1(CCC)OCCO1.
What is the InChIKey of ethane;2-heptyl-2-propyl-1,3-dioxolane?
The InChIKey is QHOLAZZEJDTMFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2.C2H6/c1-3-5-6-7-8-10-13(9-4-2)14-11-12-15-13;1-2/h3-12H2,1-2H3;1-2H3.
What are the key properties of ethane;2-heptyl-2-propyl-1,3-dioxolane?
ethane;2-heptyl-2-propyl-1,3-dioxolane has a molecular weight of 244.42 g/mol, XLogP of 4.92, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-heptyl-2-propyl-1,3-dioxolane is sourced from PubChem (CID 144819660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).