About 2-heptyl-2-oct-7-ynyl-1,3-dioxolane
2-heptyl-2-oct-7-ynyl-1,3-dioxolane (PubChem CID 57412166) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is 2-heptyl-2-oct-7-ynyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-heptyl-2-oct-7-ynyl-1,3-dioxolane |
| PubChem CID | 57412166 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 2-heptyl-2-oct-7-ynyl-1,3-dioxolane |
| SMILES | C#CCCCCCCC1(CCCCCCC)OCCO1 |
| InChI | InChI=1S/C18H32O2/c1-3-5-7-9-11-13-15-18(19-16-17-20-18)14-12-10-8-6-4-2/h1H,4-17H2,2H3 |
| InChIKey | RGMVVXHSVDFSBR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-heptyl-2-oct-7-ynyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptyl-2-oct-7-ynyl-1,3-dioxolane?
The IUPAC name of 2-heptyl-2-oct-7-ynyl-1,3-dioxolane (CID 57412166) is 2-heptyl-2-oct-7-ynyl-1,3-dioxolane.
What is the SMILES notation for 2-heptyl-2-oct-7-ynyl-1,3-dioxolane?
The canonical SMILES for 2-heptyl-2-oct-7-ynyl-1,3-dioxolane is C#CCCCCCCC1(CCCCCCC)OCCO1.
What is the InChIKey of 2-heptyl-2-oct-7-ynyl-1,3-dioxolane?
The InChIKey is RGMVVXHSVDFSBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O2/c1-3-5-7-9-11-13-15-18(19-16-17-20-18)14-12-10-8-6-4-2/h1H,4-17H2,2H3.
What are the key properties of 2-heptyl-2-oct-7-ynyl-1,3-dioxolane?
2-heptyl-2-oct-7-ynyl-1,3-dioxolane has a molecular weight of 280.45 g/mol, XLogP of 5.06, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyl-2-oct-7-ynyl-1,3-dioxolane is sourced from PubChem (CID 57412166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).