C15H27IO4 — CID 142057613
[2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]oxy hypoiodite (PubChem CID 142057613) has the molecular formula C15H27IO4 and a molecular weight of 398.28 g/mol. Its IUPAC name is [2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]oxy hypoiodite.
| Compound Name | [2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]oxy hypoiodite |
|---|---|
| PubChem CID | 142057613 |
| Molecular Formula | C15H27IO4 |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]oxy hypoiodite |
| SMILES | CCCCCC1(CCC2CCCC2OOI)OCCO1 |
| InChI | InChI=1S/C15H27IO4/c1-2-3-4-9-15(17-11-12-18-15)10-8-13-6-5-7-14(13)19-20-16/h13-14H,2-12H2,1H3 |
| InChIKey | CHRYRQDONXJQKR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|