C18H32O5 — CID 163694800
[(1S,2R)-4-ethoxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl] formate (PubChem CID 163694800) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is [(1S,2R)-4-ethoxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl] formate.
| Compound Name | [(1S,2R)-4-ethoxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl] formate |
|---|---|
| PubChem CID | 163694800 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | [(1S,2R)-4-ethoxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl] formate |
| SMILES | CCCCCC1(CC[C@@H]2CC(OCC)C[C@@H]2OC=O)OCCO1 |
| InChI | InChI=1S/C18H32O5/c1-3-5-6-8-18(22-10-11-23-18)9-7-15-12-16(20-4-2)13-17(15)21-14-19/h14-17H,3-13H2,1-2H3/t15-,16?,17+/m1/s1 |
| InChIKey | JWAXNCUCYQQLOY-SKQWJGTPSA-N |
| XLogP | 3.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|