About (2-pentylcyclopropyl) formate
(2-pentylcyclopropyl) formate (PubChem CID 57226190) has the molecular formula C9H16O2
and a molecular weight of 156.23 g/mol. Its IUPAC name is (2-pentylcyclopropyl) formate.
Molecular Properties
| Compound Name | (2-pentylcyclopropyl) formate |
| PubChem CID | 57226190 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (2-pentylcyclopropyl) formate |
| SMILES | CCCCCC1CC1OC=O |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-5-8-6-9(8)11-7-10/h7-9H,2-6H2,1H3 |
| InChIKey | GXRSASIBWKFNFJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-pentylcyclopropyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pentylcyclopropyl) formate?
The IUPAC name of (2-pentylcyclopropyl) formate (CID 57226190) is (2-pentylcyclopropyl) formate.
What is the SMILES notation for (2-pentylcyclopropyl) formate?
The canonical SMILES for (2-pentylcyclopropyl) formate is CCCCCC1CC1OC=O.
What is the InChIKey of (2-pentylcyclopropyl) formate?
The InChIKey is GXRSASIBWKFNFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-2-3-4-5-8-6-9(8)11-7-10/h7-9H,2-6H2,1H3.
What are the key properties of (2-pentylcyclopropyl) formate?
(2-pentylcyclopropyl) formate has a molecular weight of 156.23 g/mol, XLogP of 2.13, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pentylcyclopropyl) formate is sourced from PubChem (CID 57226190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).