C12H24 — CID 91692463
trans-(1S,2S)-1-butyl-2-pentylcyclopropane (PubChem CID 91692463) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is trans-(1S,2S)-1-butyl-2-pentylcyclopropane.
| Compound Name | trans-(1S,2S)-1-butyl-2-pentylcyclopropane |
|---|---|
| PubChem CID | 91692463 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | trans-(1S,2S)-1-butyl-2-pentylcyclopropane |
| SMILES | CCCCC[C@H]1C[C@@H]1CCCC |
| InChI | InChI=1S/C12H24/c1-3-5-7-9-12-10-11(12)8-6-4-2/h11-12H,3-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | JATBXZXQOFTTOL-RYUDHWBXSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|