C12H24O — CID 121360287
[(1S,2S)-2-octylcyclopropyl]methanol (PubChem CID 121360287) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is [(1S,2S)-2-octylcyclopropyl]methanol.
| Compound Name | [(1S,2S)-2-octylcyclopropyl]methanol |
|---|---|
| PubChem CID | 121360287 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | [(1S,2S)-2-octylcyclopropyl]methanol |
| SMILES | CCCCCCCC[C@H]1C[C@@H]1CO |
| InChI | InChI=1S/C12H24O/c1-2-3-4-5-6-7-8-11-9-12(11)10-13/h11-13H,2-10H2,1H3/t11-,12+/m0/s1 |
| InChIKey | WMLNTZCXPCPNDP-NWDGAFQWSA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|