C11H22O — CID 71388478
2-[(1S,2S)-2-hexylcyclopropyl]ethanol (PubChem CID 71388478) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is 2-[(1S,2S)-2-hexylcyclopropyl]ethanol.
| Compound Name | 2-[(1S,2S)-2-hexylcyclopropyl]ethanol |
|---|---|
| PubChem CID | 71388478 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 2-[(1S,2S)-2-hexylcyclopropyl]ethanol |
| SMILES | CCCCCC[C@H]1C[C@H]1CCO |
| InChI | InChI=1S/C11H22O/c1-2-3-4-5-6-10-9-11(10)7-8-12/h10-12H,2-9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | WCYLOFFSCRXLQJ-WDEREUQCSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|