About acetic acid;2-(2-octylcyclopropyl)acetic acid
acetic acid;2-(2-octylcyclopropyl)acetic acid (PubChem CID 67849608) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is acetic acid;2-(2-octylcyclopropyl)acetic acid.
Molecular Properties
| Compound Name | acetic acid;2-(2-octylcyclopropyl)acetic acid |
| PubChem CID | 67849608 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | acetic acid;2-(2-octylcyclopropyl)acetic acid |
| SMILES | CC(=O)O.CCCCCCCCC1CC1CC(=O)O |
| InChI | InChI=1S/C13H24O2.C2H4O2/c1-2-3-4-5-6-7-8-11-9-12(11)10-13(14)15;1-2(3)4/h11-12H,2-10H2,1H3,(H,14,15);1H3,(H,3,4) |
| InChIKey | NXBBOKZQNYDAFE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-(2-octylcyclopropyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-(2-octylcyclopropyl)acetic acid?
The IUPAC name of acetic acid;2-(2-octylcyclopropyl)acetic acid (CID 67849608) is acetic acid;2-(2-octylcyclopropyl)acetic acid.
What is the SMILES notation for acetic acid;2-(2-octylcyclopropyl)acetic acid?
The canonical SMILES for acetic acid;2-(2-octylcyclopropyl)acetic acid is CC(=O)O.CCCCCCCCC1CC1CC(=O)O.
What is the InChIKey of acetic acid;2-(2-octylcyclopropyl)acetic acid?
The InChIKey is NXBBOKZQNYDAFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2.C2H4O2/c1-2-3-4-5-6-7-8-11-9-12(11)10-13(14)15;1-2(3)4/h11-12H,2-10H2,1H3,(H,14,15);1H3,(H,3,4).
What are the key properties of acetic acid;2-(2-octylcyclopropyl)acetic acid?
acetic acid;2-(2-octylcyclopropyl)acetic acid has a molecular weight of 272.38 g/mol, XLogP of 3.94, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-(2-octylcyclopropyl)acetic acid is sourced from PubChem (CID 67849608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).