C11H20O2 — CID 91607184
2-[(1R,2R)-2-hexylcyclopropyl]acetic acid (PubChem CID 91607184) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-[(1R,2R)-2-hexylcyclopropyl]acetic acid.
| Compound Name | 2-[(1R,2R)-2-hexylcyclopropyl]acetic acid |
|---|---|
| PubChem CID | 91607184 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-[(1R,2R)-2-hexylcyclopropyl]acetic acid |
| SMILES | CCCCCC[C@@H]1C[C@@H]1CC(=O)O |
| InChI | InChI=1S/C11H20O2/c1-2-3-4-5-6-9-7-10(9)8-11(12)13/h9-10H,2-8H2,1H3,(H,12,13)/t9-,10-/m1/s1 |
| InChIKey | DSMAUFFXECFFMC-NXEZZACHSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|