C28H49NO7 — CID 22088138
methyl (E)-7-[5-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate (PubChem CID 22088138) has the molecular formula C28H49NO7 and a molecular weight of 511.70 g/mol. Its IUPAC name is methyl (E)-7-[5-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (E)-7-[5-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 22088138 |
| Molecular Formula | C28H49NO7 |
| Molecular Weight | 511.70 g/mol |
| Exact Mass | 511.35 |
| IUPAC Name | methyl (E)-7-[5-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC1(CCC2C(NC(=O)OC(C)(C)C)CC(O)C2C/C=C/CCCC(=O)OC)OCCO1 |
| InChI | InChI=1S/C28H49NO7/c1-6-7-12-16-28(34-18-19-35-28)17-15-21-22(13-10-8-9-11-14-25(31)33-5)24(30)20-23(21)29-26(32)36-27(2,3)4/h8,10,21-24,30H,6-7,9,11-20H2,1-5H3,(H,29,32)/b10-8+ |
| InChIKey | JXQVADQCHGFOFL-CSKARUKUSA-N |
| XLogP | 5.27 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|