C31H56O6 — CID 70148468
propan-2-yl (Z)-11-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,5-dihydroxycyclopentyl]undec-9-enoate (PubChem CID 70148468) has the molecular formula C31H56O6 and a molecular weight of 524.78 g/mol. Its IUPAC name is propan-2-yl (Z)-11-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,5-dihydroxycyclopentyl]undec-9-enoate.
| Compound Name | propan-2-yl (Z)-11-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,5-dihydroxycyclopentyl]undec-9-enoate |
|---|---|
| PubChem CID | 70148468 |
| Molecular Formula | C31H56O6 |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.41 |
| IUPAC Name | propan-2-yl (Z)-11-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,5-dihydroxycyclopentyl]undec-9-enoate |
| SMILES | CCCCCCCC1(CC[C@@H]2[C@@H](C/C=C\CCCCCCCC(=O)OC(C)C)[C@@H](O)C[C@H]2O)OCCO1 |
| InChI | InChI=1S/C31H56O6/c1-4-5-6-13-16-20-31(35-22-23-36-31)21-19-27-26(28(32)24-29(27)33)17-14-11-9-7-8-10-12-15-18-30(34)37-25(2)3/h11,14,25-29,32-33H,4-10,12-13,15-24H2,1-3H3/b14-11-/t26-,27-,28+,29-/m1/s1 |
| InChIKey | ZKQBXMNATJDWOO-FWNKFHPTSA-N |
| XLogP | 6.86 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|