C25H42AcO6S — CID 59071386
actinium;methyl (Z)-7-[(2R,3R,5S)-3-acetylsulfanyl-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate (PubChem CID 59071386) has the molecular formula C25H42AcO6S and a molecular weight of 697.67 g/mol. Its IUPAC name is actinium;methyl (Z)-7-[(2R,3R,5S)-3-acetylsulfanyl-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate.
| Compound Name | actinium;methyl (Z)-7-[(2R,3R,5S)-3-acetylsulfanyl-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59071386 |
| Molecular Formula | C25H42AcO6S |
| Molecular Weight | 697.67 g/mol |
| Exact Mass | 697.30 |
| IUPAC Name | actinium;methyl (Z)-7-[(2R,3R,5S)-3-acetylsulfanyl-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC1(CC[C@@H]2C(C/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]2SC(C)=O)OCCO1.[Ac] |
| InChI | InChI=1S/C25H42O6S.Ac/c1-4-5-10-14-25(30-16-17-31-25)15-13-21-20(22(27)18-23(21)32-19(2)26)11-8-6-7-9-12-24(28)29-3;/h6,8,20-23,27H,4-5,7,9-18H2,1-3H3;/b8-6-;/t20?,21-,22+,23-;/m1./s1 |
| InChIKey | PMURXJXLBFXCQJ-JQACNXKKSA-N |
| XLogP | 5.02 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|