C25H42O5S — CID 88734730
methyl (Z)-7-[(1R,2R,3R,5S)-5-acetylsulfanyl-3-hydroxy-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 88734730) has the molecular formula C25H42O5S and a molecular weight of 454.67 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-5-acetylsulfanyl-3-hydroxy-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-acetylsulfanyl-3-hydroxy-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 88734730 |
| Molecular Formula | C25H42O5S |
| Molecular Weight | 454.67 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-acetylsulfanyl-3-hydroxy-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCC(C)(C)[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@H](SC(C)=O)C[C@H]1O |
| InChI | InChI=1S/C25H42O5S/c1-6-7-16-25(3,4)23(28)15-14-19-20(22(17-21(19)27)31-18(2)26)12-10-8-9-11-13-24(29)30-5/h8,10,14-15,19-23,27-28H,6-7,9,11-13,16-17H2,1-5H3/b10-8-,15-14+/t19-,20-,21-,22+,23-/m1/s1 |
| InChIKey | ULKSPXVXCUCARB-XDMVQOILSA-N |
| XLogP | 5.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|