C23H39N3O4 — CID 57030729
methyl 7-[(1R,2R,3R,5S)-5-azido-3-hydroxy-2-[(3R,5S)-3-hydroxy-5-methylnon-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 57030729) has the molecular formula C23H39N3O4 and a molecular weight of 421.58 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-azido-3-hydroxy-2-[(3R,5S)-3-hydroxy-5-methylnon-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-azido-3-hydroxy-2-[(3R,5S)-3-hydroxy-5-methylnon-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 57030729 |
| Molecular Formula | C23H39N3O4 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-azido-3-hydroxy-2-[(3R,5S)-3-hydroxy-5-methylnon-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCC[C@H](C)C[C@@H](O)C=C[C@@H]1[C@@H](CC=CCCCC(=O)OC)[C@@H](N=[N+]=[N-])C[C@H]1O |
| InChI | InChI=1S/C23H39N3O4/c1-4-5-10-17(2)15-18(27)13-14-20-19(21(25-26-24)16-22(20)28)11-8-6-7-9-12-23(29)30-3/h6,8,13-14,17-22,27-28H,4-5,7,9-12,15-16H2,1-3H3/t17-,18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | WLBVYZGLAHTHQN-QANWUKQVSA-N |
| XLogP | 5.09 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|