C22H37BrO4 — CID 56634510
methyl 7-[(1R,2R,3R,5S)-5-bromo-3-hydroxy-2-[(3S)-3-hydroxy-4-methyloct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 56634510) has the molecular formula C22H37BrO4 and a molecular weight of 445.44 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-bromo-3-hydroxy-2-[(3S)-3-hydroxy-4-methyloct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-bromo-3-hydroxy-2-[(3S)-3-hydroxy-4-methyloct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 56634510 |
| Molecular Formula | C22H37BrO4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-bromo-3-hydroxy-2-[(3S)-3-hydroxy-4-methyloct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCC(C)[C@H](O)C=C[C@@H]1[C@@H](CC=CCCCC(=O)OC)[C@@H](Br)C[C@H]1O |
| InChI | InChI=1S/C22H37BrO4/c1-4-5-10-16(2)20(24)14-13-18-17(19(23)15-21(18)25)11-8-6-7-9-12-22(26)27-3/h6,8,13-14,16-21,24-25H,4-5,7,9-12,15H2,1-3H3/t16?,17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | PWIHBMSBBQRURF-FOJWHBMDSA-N |
| XLogP | 4.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|