C23H41BrO4 — CID 70464949
methyl 7-[(1R,2R,3R,5S)-5-bromo-3-hydroxy-2-[(E,3S)-3-hydroxy-4,7-dimethyloct-1-enyl]cyclopentyl]heptanoate (PubChem CID 70464949) has the molecular formula C23H41BrO4 and a molecular weight of 461.48 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-bromo-3-hydroxy-2-[(E,3S)-3-hydroxy-4,7-dimethyloct-1-enyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-bromo-3-hydroxy-2-[(E,3S)-3-hydroxy-4,7-dimethyloct-1-enyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70464949 |
| Molecular Formula | C23H41BrO4 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-bromo-3-hydroxy-2-[(E,3S)-3-hydroxy-4,7-dimethyloct-1-enyl]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](/C=C/[C@@H](O)C(C)CCC(C)C)[C@H](O)C[C@@H]1Br |
| InChI | InChI=1S/C23H41BrO4/c1-16(2)11-12-17(3)21(25)14-13-19-18(20(24)15-22(19)26)9-7-5-6-8-10-23(27)28-4/h13-14,16-22,25-26H,5-12,15H2,1-4H3/b14-13+/t17?,18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | SFHMZOUDJQIYPR-QLDCAXMLSA-N |
| XLogP | 5.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|