C23H41ClO5 — CID 68932079
propyl 7-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]heptanoate (PubChem CID 68932079) has the molecular formula C23H41ClO5 and a molecular weight of 433.03 g/mol. Its IUPAC name is propyl 7-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]heptanoate.
| Compound Name | propyl 7-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 68932079 |
| Molecular Formula | C23H41ClO5 |
| Molecular Weight | 433.03 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | propyl 7-[(1R,2R,3R,5R)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxycyclopentyl]heptanoate |
| SMILES | CCCOC(=O)CCCCCC[C@@H]1[C@@H](C=C[C@@H](O)CCC[C@@H](C)O)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C23H41ClO5/c1-3-15-29-23(28)12-7-5-4-6-11-19-20(22(27)16-21(19)24)14-13-18(26)10-8-9-17(2)25/h13-14,17-22,25-27H,3-12,15-16H2,1-2H3/t17-,18+,19-,20-,21-,22-/m1/s1 |
| InChIKey | QSYBMZSGWULJGH-DRGMGAIOSA-N |
| XLogP | 4.35 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.03 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|