C23H42O7 — CID 156963876
[(2S)-2,3-dihydroxypropyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoate (PubChem CID 156963876) has the molecular formula C23H42O7 and a molecular weight of 430.58 g/mol. Its IUPAC name is [(2S)-2,3-dihydroxypropyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoate.
| Compound Name | [(2S)-2,3-dihydroxypropyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 156963876 |
| Molecular Formula | C23H42O7 |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | [(2S)-2,3-dihydroxypropyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](CCCCCCC(=O)OC[C@@H](O)CO)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H42O7/c1-2-3-6-9-17(25)12-13-20-19(21(27)14-22(20)28)10-7-4-5-8-11-23(29)30-16-18(26)15-24/h12-13,17-22,24-28H,2-11,14-16H2,1H3/b13-12+/t17-,18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | QUXXWFCCGPDOIB-ISWYLGGCSA-N |
| XLogP | 2.08 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|