C42H77O13P — CID 156972108
[(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] (Z)-hexadec-9-enoate (PubChem CID 156972108) has the molecular formula C42H77O13P and a molecular weight of 821.04 g/mol. Its IUPAC name is [(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] (Z)-hexadec-9-enoate.
| Compound Name | [(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 156972108 |
| Molecular Formula | C42H77O13P |
| Molecular Weight | 821.04 g/mol |
| Exact Mass | 820.51 |
| IUPAC Name | [(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCC[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]1O)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C42H77O13P/c1-3-5-7-8-9-10-11-12-13-14-15-16-22-26-42(49)55-36(33-54-56(50,51)53-31-35(45)30-43)32-52-41(48)25-21-18-17-20-24-37-38(40(47)29-39(37)46)28-27-34(44)23-19-6-4-2/h10-11,27-28,34-40,43-47H,3-9,12-26,29-33H2,1-2H3,(H,50,51)/b11-10-,28-27+/t34-,35-,36+,37+,38+,39-,40+/m0/s1 |
| InChIKey | CSKVUJMEFCGTHX-BABXZQPPSA-N |
| XLogP | 7.38 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.04 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|