C41H75O11P — CID 156967130
[(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]-3-phosphonooxypropan-2-yl] (Z)-octadec-11-enoate (PubChem CID 156967130) has the molecular formula C41H75O11P and a molecular weight of 775.01 g/mol. Its IUPAC name is [(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]-3-phosphonooxypropan-2-yl] (Z)-octadec-11-enoate.
| Compound Name | [(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]-3-phosphonooxypropan-2-yl] (Z)-octadec-11-enoate |
|---|---|
| PubChem CID | 156967130 |
| Molecular Formula | C41H75O11P |
| Molecular Weight | 775.01 g/mol |
| Exact Mass | 774.50 |
| IUPAC Name | [(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]-3-phosphonooxypropan-2-yl] (Z)-octadec-11-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCCCCC[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]1O)COP(=O)(O)O |
| InChI | InChI=1S/C41H75O11P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-24-28-41(46)52-35(33-51-53(47,48)49)32-50-40(45)27-23-20-19-22-26-36-37(39(44)31-38(36)43)30-29-34(42)25-21-6-4-2/h10-11,29-30,34-39,42-44H,3-9,12-28,31-33H2,1-2H3,(H2,47,48,49)/b11-10-,30-29+/t34-,35+,36+,37+,38-,39+/m0/s1 |
| InChIKey | QTDRINOJEPTDHM-SDVXTUTHSA-N |
| XLogP | 8.78 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.01 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|