C39H72NO11P — CID 156964127
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]propyl] (Z)-tetradec-9-enoate (PubChem CID 156964127) has the molecular formula C39H72NO11P and a molecular weight of 761.97 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]propyl] (Z)-tetradec-9-enoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]propyl] (Z)-tetradec-9-enoate |
|---|---|
| PubChem CID | 156964127 |
| Molecular Formula | C39H72NO11P |
| Molecular Weight | 761.97 g/mol |
| Exact Mass | 761.48 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoyloxy]propyl] (Z)-tetradec-9-enoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCC[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C39H72NO11P/c1-3-5-7-8-9-10-11-12-13-14-19-23-38(44)48-30-33(31-50-52(46,47)49-28-27-40)51-39(45)24-20-16-15-18-22-34-35(37(43)29-36(34)42)26-25-32(41)21-17-6-4-2/h8-9,25-26,32-37,41-43H,3-7,10-24,27-31,40H2,1-2H3,(H,46,47)/b9-8-,26-25+/t32-,33+,34+,35+,36-,37+/m0/s1 |
| InChIKey | BMTUIEPNBVVOGP-XTEQUKNXSA-N |
| XLogP | 7.21 |
| TPSA | 195.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.97 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|