C35H61O11P — CID 156966454
[(2R)-2-[(Z)-5-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]pent-3-enoyl]oxy-3-phosphonooxypropyl] (Z)-tetradec-9-enoate (PubChem CID 156966454) has the molecular formula C35H61O11P and a molecular weight of 688.84 g/mol. Its IUPAC name is [(2R)-2-[(Z)-5-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]pent-3-enoyl]oxy-3-phosphonooxypropyl] (Z)-tetradec-9-enoate.
| Compound Name | [(2R)-2-[(Z)-5-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]pent-3-enoyl]oxy-3-phosphonooxypropyl] (Z)-tetradec-9-enoate |
|---|---|
| PubChem CID | 156966454 |
| Molecular Formula | C35H61O11P |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 688.40 |
| IUPAC Name | [(2R)-2-[(Z)-5-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]pent-3-enoyl]oxy-3-phosphonooxypropyl] (Z)-tetradec-9-enoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)C/C=C\C[C@H]1[C@@H](/C=C/[C@H](O)CCCCC)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C35H61O11P/c1-3-5-7-8-9-10-11-12-13-14-16-21-34(39)44-26-29(27-45-47(41,42)43)46-35(40)22-18-17-20-30-31(33(38)25-32(30)37)24-23-28(36)19-15-6-4-2/h8-9,17-18,23-24,28-33,36-38H,3-7,10-16,19-22,25-27H2,1-2H3,(H2,41,42,43)/b9-8-,18-17-,24-23+/t28-,29-,30+,31-,32+,33-/m1/s1 |
| InChIKey | GNAFFPSUEJSNMU-DXNAEKGHSA-N |
| XLogP | 6.22 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|