C36H65O11P — CID 156970801
[(2R)-2-[(E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] 11-methyldodecanoate (PubChem CID 156970801) has the molecular formula C36H65O11P and a molecular weight of 704.88 g/mol. Its IUPAC name is [(2R)-2-[(E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] 11-methyldodecanoate.
| Compound Name | [(2R)-2-[(E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] 11-methyldodecanoate |
|---|---|
| PubChem CID | 156970801 |
| Molecular Formula | C36H65O11P |
| Molecular Weight | 704.88 g/mol |
| Exact Mass | 704.43 |
| IUPAC Name | [(2R)-2-[(E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] 11-methyldodecanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C/CCCC(=O)O[C@H](COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C36H65O11P/c1-4-5-13-19-29(37)23-24-32-31(33(38)25-34(32)39)20-15-11-12-17-22-36(41)47-30(27-46-48(42,43)44)26-45-35(40)21-16-10-8-6-7-9-14-18-28(2)3/h11,15,23-24,28-34,37-39H,4-10,12-14,16-22,25-27H2,1-3H3,(H2,42,43,44)/b15-11+,24-23+/t29-,30+,31+,32+,33-,34+/m0/s1 |
| InChIKey | XMTFCDIWECMZCA-XLSPUGJHSA-N |
| XLogP | 6.69 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.88 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|