C34H61O11P — CID 156970816
[(2R)-1-[(Z)-5-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]pent-3-enoyl]oxy-3-phosphonooxypropan-2-yl] 11-methyldodecanoate (PubChem CID 156970816) has the molecular formula C34H61O11P and a molecular weight of 676.83 g/mol. Its IUPAC name is [(2R)-1-[(Z)-5-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]pent-3-enoyl]oxy-3-phosphonooxypropan-2-yl] 11-methyldodecanoate.
| Compound Name | [(2R)-1-[(Z)-5-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]pent-3-enoyl]oxy-3-phosphonooxypropan-2-yl] 11-methyldodecanoate |
|---|---|
| PubChem CID | 156970816 |
| Molecular Formula | C34H61O11P |
| Molecular Weight | 676.83 g/mol |
| Exact Mass | 676.40 |
| IUPAC Name | [(2R)-1-[(Z)-5-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]pent-3-enoyl]oxy-3-phosphonooxypropan-2-yl] 11-methyldodecanoate |
| SMILES | CCCCC[C@@H](O)/C=C/[C@@H]1[C@H](C/C=C\CC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCCC(C)C)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C34H61O11P/c1-4-5-11-17-27(35)21-22-30-29(31(36)23-32(30)37)18-14-15-19-33(38)43-24-28(25-44-46(40,41)42)45-34(39)20-13-10-8-6-7-9-12-16-26(2)3/h14-15,21-22,26-32,35-37H,4-13,16-20,23-25H2,1-3H3,(H2,40,41,42)/b15-14-,22-21+/t27-,28-,29+,30-,31+,32-/m1/s1 |
| InChIKey | WFKPMMUONBWLRL-URKFYYKISA-N |
| XLogP | 5.91 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.83 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|