C43H77O12P — CID 156968101
[(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-icos-11-enoate (PubChem CID 156968101) has the molecular formula C43H77O12P and a molecular weight of 817.05 g/mol. Its IUPAC name is [(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-icos-11-enoate.
| Compound Name | [(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 156968101 |
| Molecular Formula | C43H77O12P |
| Molecular Weight | 817.05 g/mol |
| Exact Mass | 816.52 |
| IUPAC Name | [(2R)-1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-6-oxoheptanoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCCCC(=O)C[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]1O)COP(=O)(O)O |
| InChI | InChI=1S/C43H77O12P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-28-43(49)55-37(34-54-56(50,51)52)33-53-42(48)27-24-23-26-36(45)31-39-38(40(46)32-41(39)47)30-29-35(44)25-21-6-4-2/h12-13,29-30,35,37-41,44,46-47H,3-11,14-28,31-34H2,1-2H3,(H2,50,51,52)/b13-12-,30-29+/t35-,37+,38+,39+,40+,41-/m0/s1 |
| InChIKey | YIFCRKVYVUPPDN-CPEJXBMISA-N |
| XLogP | 8.74 |
| TPSA | 197.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.05 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|