C28H49ClO6 — CID 68928276
propyl 7-[(1R,2S,3R,5S)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 68928276) has the molecular formula C28H49ClO6 and a molecular weight of 517.15 g/mol. Its IUPAC name is propyl 7-[(1R,2S,3R,5S)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | propyl 7-[(1R,2S,3R,5S)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 68928276 |
| Molecular Formula | C28H49ClO6 |
| Molecular Weight | 517.15 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | propyl 7-[(1R,2S,3R,5S)-5-chloro-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | CCCOC(=O)CCCCCC[C@@H]1[C@H](C=C[C@@H](O)CCC[C@@H](C)O)[C@H](OC2CCCCO2)C[C@@H]1Cl |
| InChI | InChI=1S/C28H49ClO6/c1-3-18-33-27(32)14-7-5-4-6-13-23-24(17-16-22(31)12-10-11-21(2)30)26(20-25(23)29)35-28-15-8-9-19-34-28/h16-17,21-26,28,30-31H,3-15,18-20H2,1-2H3/t21-,22+,23-,24+,25+,26-,28?/m1/s1 |
| InChIKey | SGTBTXSZWVGSDS-SFVVGJSXSA-N |
| XLogP | 5.90 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.15 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|