C44H70O10S — CID 91283524
2-[4-[2-[(1R,2R,3R,5S)-5-hydroxy-2-[(3S)-4-[3-(methoxymethyl)phenyl]-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]ethylsulfanyl]butanoyloxy]ethyl nonanoate (PubChem CID 91283524) has the molecular formula C44H70O10S and a molecular weight of 791.10 g/mol. Its IUPAC name is 2-[4-[2-[(1R,2R,3R,5S)-5-hydroxy-2-[(3S)-4-[3-(methoxymethyl)phenyl]-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]ethylsulfanyl]butanoyloxy]ethyl nonanoate.
| Compound Name | 2-[4-[2-[(1R,2R,3R,5S)-5-hydroxy-2-[(3S)-4-[3-(methoxymethyl)phenyl]-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]ethylsulfanyl]butanoyloxy]ethyl nonanoate |
|---|---|
| PubChem CID | 91283524 |
| Molecular Formula | C44H70O10S |
| Molecular Weight | 791.10 g/mol |
| Exact Mass | 790.47 |
| IUPAC Name | 2-[4-[2-[(1R,2R,3R,5S)-5-hydroxy-2-[(3S)-4-[3-(methoxymethyl)phenyl]-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]ethylsulfanyl]butanoyloxy]ethyl nonanoate |
| SMILES | CCCCCCCCC(=O)OCCOC(=O)CCCSCC[C@@H]1[C@@H](C=C[C@H](Cc2cccc(COC)c2)OC2CCCCO2)[C@H](OC2CCCCO2)C[C@@H]1O |
| InChI | InChI=1S/C44H70O10S/c1-3-4-5-6-7-8-17-41(46)49-26-27-50-42(47)18-14-28-55-29-23-37-38(40(32-39(37)45)54-44-20-10-12-25-52-44)22-21-36(53-43-19-9-11-24-51-43)31-34-15-13-16-35(30-34)33-48-2/h13,15-16,21-22,30,36-40,43-45H,3-12,14,17-20,23-29,31-33H2,1-2H3/t36-,37-,38-,39+,40-,43?,44?/m1/s1 |
| InChIKey | IQQDSOIFBLBBKM-QNALNBSLSA-N |
| XLogP | 8.49 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.10 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|