C31H51FO7 — CID 57303379
methyl (7S)-7-fluoro-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 57303379) has the molecular formula C31H51FO7 and a molecular weight of 554.74 g/mol. Its IUPAC name is methyl (7S)-7-fluoro-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (7S)-7-fluoro-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 57303379 |
| Molecular Formula | C31H51FO7 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | methyl (7S)-7-fluoro-7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@@H](C=C[C@@H]1[C@@H]([C@@H](F)C=CCCCC(=O)OC)[C@@H](O)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C31H51FO7/c1-3-4-6-13-23(38-29-16-9-11-20-36-29)18-19-24-27(39-30-17-10-12-21-37-30)22-26(33)31(24)25(32)14-7-5-8-15-28(34)35-2/h7,14,18-19,23-27,29-31,33H,3-6,8-13,15-17,20-22H2,1-2H3/t23-,24-,25-,26-,27+,29?,30?,31-/m0/s1 |
| InChIKey | HGQFEGBFNPLSKS-RIXZZKSVSA-N |
| XLogP | 6.18 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|