C27H45FO5 — CID 56991013
methyl (7S)-7-fluoro-7-[(1R,2R,3R,5S)-5-hydroxy-2-oct-1-enyl-3-(oxan-2-yloxy)cyclopentyl]-5-methylhept-5-enoate (PubChem CID 56991013) has the molecular formula C27H45FO5 and a molecular weight of 468.65 g/mol. Its IUPAC name is methyl (7S)-7-fluoro-7-[(1R,2R,3R,5S)-5-hydroxy-2-oct-1-enyl-3-(oxan-2-yloxy)cyclopentyl]-5-methylhept-5-enoate.
| Compound Name | methyl (7S)-7-fluoro-7-[(1R,2R,3R,5S)-5-hydroxy-2-oct-1-enyl-3-(oxan-2-yloxy)cyclopentyl]-5-methylhept-5-enoate |
|---|---|
| PubChem CID | 56991013 |
| Molecular Formula | C27H45FO5 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | methyl (7S)-7-fluoro-7-[(1R,2R,3R,5S)-5-hydroxy-2-oct-1-enyl-3-(oxan-2-yloxy)cyclopentyl]-5-methylhept-5-enoate |
| SMILES | CCCCCCC=C[C@@H]1[C@@H]([C@@H](F)C=C(C)CCCC(=O)OC)[C@@H](O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C27H45FO5/c1-4-5-6-7-8-9-14-21-24(33-26-16-10-11-17-32-26)19-23(29)27(21)22(28)18-20(2)13-12-15-25(30)31-3/h9,14,18,21-24,26-27,29H,4-8,10-13,15-17,19H2,1-3H3/t21-,22-,23-,24+,26?,27-/m0/s1 |
| InChIKey | BEOVFHHBQXHGFH-RQLZVPAXSA-N |
| XLogP | 6.05 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|