C29H50O7 — CID 11027623
methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 11027623) has the molecular formula C29H50O7 and a molecular weight of 510.71 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 11027623 |
| Molecular Formula | C29H50O7 |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | CCCCC(C)(O)C/C=C/[C@@H]1[C@@H](CCCCCCC(=O)OC)[C@@H](OC(C)=O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C29H50O7/c1-5-6-18-29(3,32)19-13-15-24-23(14-9-7-8-10-16-27(31)33-4)25(35-22(2)30)21-26(24)36-28-17-11-12-20-34-28/h13,15,23-26,28,32H,5-12,14,16-21H2,1-4H3/b15-13+/t23-,24-,25+,26-,28?,29?/m1/s1 |
| InChIKey | KOYVBCWQPOSTAJ-JGSRATIXSA-N |
| XLogP | 5.87 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|