C33H60O6Si — CID 70634653
methyl 7-[2-[(4S)-4-methyl-4-triethylsilyloxyoct-1-enyl]-3-[(2R)-oxan-2-yl]oxy-5-oxocyclopentyl]heptanoate (PubChem CID 70634653) has the molecular formula C33H60O6Si and a molecular weight of 580.92 g/mol. Its IUPAC name is methyl 7-[2-[(4S)-4-methyl-4-triethylsilyloxyoct-1-enyl]-3-[(2R)-oxan-2-yl]oxy-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[2-[(4S)-4-methyl-4-triethylsilyloxyoct-1-enyl]-3-[(2R)-oxan-2-yl]oxy-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70634653 |
| Molecular Formula | C33H60O6Si |
| Molecular Weight | 580.92 g/mol |
| Exact Mass | 580.42 |
| IUPAC Name | methyl 7-[2-[(4S)-4-methyl-4-triethylsilyloxyoct-1-enyl]-3-[(2R)-oxan-2-yl]oxy-5-oxocyclopentyl]heptanoate |
| SMILES | CCCC[C@@](C)(CC=CC1C(O[C@@H]2CCCCO2)CC(=O)C1CCCCCCC(=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H60O6Si/c1-7-11-23-33(5,39-40(8-2,9-3)10-4)24-18-20-28-27(19-14-12-13-15-21-31(35)36-6)29(34)26-30(28)38-32-22-16-17-25-37-32/h18,20,27-28,30,32H,7-17,19,21-26H2,1-6H3/t27?,28?,30?,32-,33+/m1/s1 |
| InChIKey | VCEWGEOTPFPFRN-FYAKWIHVSA-N |
| XLogP | 8.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.92 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|