C32H52O8 — CID 57167631
methyl 7-[(1R,2R,3R)-2-[(3S,5S)-5-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoate (PubChem CID 57167631) has the molecular formula C32H52O8 and a molecular weight of 564.76 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-2-[(3S,5S)-5-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-2-[(3S,5S)-5-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoate |
|---|---|
| PubChem CID | 57167631 |
| Molecular Formula | C32H52O8 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.37 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-2-[(3S,5S)-5-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoate |
| SMILES | CCC[C@H](C)C[C@@H](C=C[C@H]1[C@H](OC2CCCCO2)CC(=O)[C@@H]1CC(=O)CCCCC(=O)OC)OC1CCCCO1 |
| InChI | InChI=1S/C32H52O8/c1-4-11-23(2)20-25(39-31-14-7-9-18-37-31)16-17-26-27(21-24(33)12-5-6-13-30(35)36-3)28(34)22-29(26)40-32-15-8-10-19-38-32/h16-17,23,25-27,29,31-32H,4-15,18-22H2,1-3H3/t23-,25+,26+,27+,29+,31?,32?/m0/s1 |
| InChIKey | NNJSGJHUCUQRRX-JCOPQPHLSA-N |
| XLogP | 6.09 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|