C35H57NO9 — CID 57264734
methyl 2-[[7-[(1R,2R,3R)-2-[(3R,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoyl]amino]acetate (PubChem CID 57264734) has the molecular formula C35H57NO9 and a molecular weight of 635.84 g/mol. Its IUPAC name is methyl 2-[[7-[(1R,2R,3R)-2-[(3R,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoyl]amino]acetate.
| Compound Name | methyl 2-[[7-[(1R,2R,3R)-2-[(3R,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoyl]amino]acetate |
|---|---|
| PubChem CID | 57264734 |
| Molecular Formula | C35H57NO9 |
| Molecular Weight | 635.84 g/mol |
| Exact Mass | 635.40 |
| IUPAC Name | methyl 2-[[7-[(1R,2R,3R)-2-[(3R,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoyl]amino]acetate |
| SMILES | CCCC[C@H](C)C[C@H](C=C[C@H]1[C@H](OC2CCCCO2)CC(=O)[C@@H]1CC(=O)CCCCC(=O)NCC(=O)OC)OC1CCCCO1 |
| InChI | InChI=1S/C35H57NO9/c1-4-5-12-25(2)21-27(44-34-15-8-10-19-42-34)17-18-28-29(30(38)23-31(28)45-35-16-9-11-20-43-35)22-26(37)13-6-7-14-32(39)36-24-33(40)41-3/h17-18,25,27-29,31,34-35H,4-16,19-24H2,1-3H3,(H,36,39)/t25-,27-,28+,29+,31+,34?,35?/m0/s1 |
| InChIKey | DAKZQNMELGUVEZ-XDOKCUSGSA-N |
| XLogP | 5.60 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.84 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|