C33H56O8 — CID 13055586
methyl 7-[(1R,2R,3R)-2-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-3-hydroxyheptanoate (PubChem CID 13055586) has the molecular formula C33H56O8 and a molecular weight of 580.80 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-2-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-3-hydroxyheptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-2-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-3-hydroxyheptanoate |
|---|---|
| PubChem CID | 13055586 |
| Molecular Formula | C33H56O8 |
| Molecular Weight | 580.80 g/mol |
| Exact Mass | 580.40 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-2-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-3-hydroxyheptanoate |
| SMILES | CCCCC(C)(C)[C@@H](/C=C/[C@H]1[C@H](OC2CCCCO2)CC(=O)[C@@H]1CCCCC(O)CC(=O)OC)OC1CCCCO1 |
| InChI | InChI=1S/C33H56O8/c1-5-6-19-33(2,3)29(41-32-16-10-12-21-39-32)18-17-26-25(14-8-7-13-24(34)22-30(36)37-4)27(35)23-28(26)40-31-15-9-11-20-38-31/h17-18,24-26,28-29,31-32,34H,5-16,19-23H2,1-4H3/b18-17+/t24?,25-,26-,28-,29-,31?,32?/m1/s1 |
| InChIKey | XVACGIIIGCSWRG-IWLGMVCYSA-N |
| XLogP | 6.27 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.80 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|