C35H58O10S — CID 10327143
methyl 2-[2-[(3aR,4R,5R,6aS)-4-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-3-methylsulfonyloxypropoxy]acetate (PubChem CID 10327143) has the molecular formula C35H58O10S and a molecular weight of 670.91 g/mol. Its IUPAC name is methyl 2-[2-[(3aR,4R,5R,6aS)-4-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-3-methylsulfonyloxypropoxy]acetate.
| Compound Name | methyl 2-[2-[(3aR,4R,5R,6aS)-4-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-3-methylsulfonyloxypropoxy]acetate |
|---|---|
| PubChem CID | 10327143 |
| Molecular Formula | C35H58O10S |
| Molecular Weight | 670.91 g/mol |
| Exact Mass | 670.38 |
| IUPAC Name | methyl 2-[2-[(3aR,4R,5R,6aS)-4-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-3-methylsulfonyloxypropoxy]acetate |
| SMILES | CCCCC(C)(C)[C@@H](/C=C/[C@@H]1[C@H]2C=C(C(COCC(=O)OC)COS(C)(=O)=O)C[C@H]2C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C35H58O10S/c1-6-7-16-35(2,3)31(45-34-13-9-11-18-42-34)15-14-28-29-20-25(19-26(29)21-30(28)44-33-12-8-10-17-41-33)27(23-43-46(5,37)38)22-40-24-32(36)39-4/h14-15,20,26-31,33-34H,6-13,16-19,21-24H2,1-5H3/b15-14+/t26-,27?,28+,29-,30+,31+,33?,34?/m0/s1 |
| InChIKey | BOXAUNIUTXCANT-IUHVALBSSA-N |
| XLogP | 5.95 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.91 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|