C38H56O7 — CID 10100470
methyl 2-[(3aR,4R,5R,6aS)-4-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-3-phenylmethoxypropanoate (PubChem CID 10100470) has the molecular formula C38H56O7 and a molecular weight of 624.86 g/mol. Its IUPAC name is methyl 2-[(3aR,4R,5R,6aS)-4-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-3-phenylmethoxypropanoate.
| Compound Name | methyl 2-[(3aR,4R,5R,6aS)-4-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-3-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 10100470 |
| Molecular Formula | C38H56O7 |
| Molecular Weight | 624.86 g/mol |
| Exact Mass | 624.40 |
| IUPAC Name | methyl 2-[(3aR,4R,5R,6aS)-4-[(E,3S)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-3-phenylmethoxypropanoate |
| SMILES | CCCCC(C)[C@@H](/C=C/[C@@H]1[C@H]2C=C(C(COCc3ccccc3)C(=O)OC)C[C@H]2C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C38H56O7/c1-4-5-13-27(2)34(44-36-16-9-11-20-42-36)19-18-31-32-23-29(22-30(32)24-35(31)45-37-17-10-12-21-43-37)33(38(39)40-3)26-41-25-28-14-7-6-8-15-28/h6-8,14-15,18-19,23,27,30-37H,4-5,9-13,16-17,20-22,24-26H2,1-3H3/b19-18+/t27?,30-,31+,32-,33?,34+,35+,36?,37?/m0/s1 |
| InChIKey | TWJSRFKHKROQIK-NVWZFPLKSA-N |
| XLogP | 7.78 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.86 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|